C32H36N4O3S — CID 146253726
N-[4-[4-[(3-butoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]phenyl]quinoline-8-sulfinamide (PubChem CID 146253726) has the molecular formula C32H36N4O3S and a molecular weight of 556.73 g/mol. Its IUPAC name is N-[4-[4-[(3-butoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]phenyl]quinoline-8-sulfinamide.
| Compound Name | N-[4-[4-[(3-butoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]phenyl]quinoline-8-sulfinamide |
|---|---|
| PubChem CID | 146253726 |
| Molecular Formula | C32H36N4O3S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[4-[4-[(3-butoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]phenyl]quinoline-8-sulfinamide |
| SMILES | CCCCOc1cccc(CN2CCCN(C(=O)c3ccc(NS(=O)c4cccc5cccnc45)cc3)CC2)c1 |
| InChI | InChI=1S/C32H36N4O3S/c1-2-3-22-39-29-11-4-8-25(23-29)24-35-18-7-19-36(21-20-35)32(37)27-13-15-28(16-14-27)34-40(38)30-12-5-9-26-10-6-17-33-31(26)30/h4-6,8-17,23,34H,2-3,7,18-22,24H2,1H3 |
| InChIKey | WGWYTTVTXBVUOK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|