C25H24F2N6OS — CID 146257028
5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-[(4-methoxyphenyl)methylamino]pyrazolo[1,5-c]pyrimidine-3-carbothioamide (PubChem CID 146257028) has the molecular formula C25H24F2N6OS and a molecular weight of 494.57 g/mol. Its IUPAC name is 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-[(4-methoxyphenyl)methylamino]pyrazolo[1,5-c]pyrimidine-3-carbothioamide.
| Compound Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-[(4-methoxyphenyl)methylamino]pyrazolo[1,5-c]pyrimidine-3-carbothioamide |
|---|---|
| PubChem CID | 146257028 |
| Molecular Formula | C25H24F2N6OS |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-[(4-methoxyphenyl)methylamino]pyrazolo[1,5-c]pyrimidine-3-carbothioamide |
| SMILES | COc1ccc(CNc2nn3cnc(N4CCCC4c4cc(F)ccc4F)cc3c2C(N)=S)cc1 |
| InChI | InChI=1S/C25H24F2N6OS/c1-34-17-7-4-15(5-8-17)13-29-25-23(24(28)35)21-12-22(30-14-33(21)31-25)32-10-2-3-20(32)18-11-16(26)6-9-19(18)27/h4-9,11-12,14,20H,2-3,10,13H2,1H3,(H2,28,35)(H,29,31) |
| InChIKey | XOYVMTVPSOJUGE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|