C26H27Cl2N7O — CID 146257109
N-[1-[9-(4-chlorophenyl)-8-(3-chloro-4-pyridinyl)purin-6-yl]piperidin-4-yl]pentanamide (PubChem CID 146257109) has the molecular formula C26H27Cl2N7O and a molecular weight of 524.46 g/mol. Its IUPAC name is N-[1-[9-(4-chlorophenyl)-8-(3-chloro-4-pyridinyl)purin-6-yl]piperidin-4-yl]pentanamide.
| Compound Name | N-[1-[9-(4-chlorophenyl)-8-(3-chloro-4-pyridinyl)purin-6-yl]piperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 146257109 |
| Molecular Formula | C26H27Cl2N7O |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | N-[1-[9-(4-chlorophenyl)-8-(3-chloro-4-pyridinyl)purin-6-yl]piperidin-4-yl]pentanamide |
| SMILES | CCCCC(=O)NC1CCN(c2ncnc3c2nc(-c2ccncc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27Cl2N7O/c1-2-3-4-22(36)32-18-10-13-34(14-11-18)25-23-26(31-16-30-25)35(19-7-5-17(27)6-8-19)24(33-23)20-9-12-29-15-21(20)28/h5-9,12,15-16,18H,2-4,10-11,13-14H2,1H3,(H,32,36) |
| InChIKey | OFOSEEPMBSZWCU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |