C26H26Cl2N6O — CID 58154389
1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-propylpiperidine-4-carboxamide (PubChem CID 58154389) has the molecular formula C26H26Cl2N6O and a molecular weight of 509.44 g/mol. Its IUPAC name is 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-propylpiperidine-4-carboxamide.
| Compound Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-propylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58154389 |
| Molecular Formula | C26H26Cl2N6O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-propylpiperidine-4-carboxamide |
| SMILES | CCCC1(C(N)=O)CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H26Cl2N6O/c1-2-11-26(25(29)35)12-14-33(15-13-26)23-21-24(31-16-30-23)34(18-9-7-17(27)8-10-18)22(32-21)19-5-3-4-6-20(19)28/h3-10,16H,2,11-15H2,1H3,(H2,29,35) |
| InChIKey | HHBPLKMWFGGEST-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |