C24H22Cl2N6O — CID 143942385
1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidine-4-carboxamide (PubChem CID 143942385) has the molecular formula C24H22Cl2N6O and a molecular weight of 481.39 g/mol. Its IUPAC name is 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidine-4-carboxamide.
| Compound Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 143942385 |
| Molecular Formula | C24H22Cl2N6O |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidine-4-carboxamide |
| SMILES | CC1(C(N)=O)CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H22Cl2N6O/c1-24(23(27)33)10-12-31(13-11-24)21-19-22(29-14-28-21)32(16-8-6-15(25)7-9-16)20(30-19)17-4-2-3-5-18(17)26/h2-9,14H,10-13H2,1H3,(H2,27,33) |
| InChIKey | NKQSWJUUCWTSIW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |