C30H25Cl2N7O4 — CID 135156441
(4-nitrophenyl) N-[1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidin-4-yl]carbamate (PubChem CID 135156441) has the molecular formula C30H25Cl2N7O4 and a molecular weight of 618.48 g/mol. Its IUPAC name is (4-nitrophenyl) N-[1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidin-4-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 135156441 |
| Molecular Formula | C30H25Cl2N7O4 |
| Molecular Weight | 618.48 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | (4-nitrophenyl) N-[1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-methylpiperidin-4-yl]carbamate |
| SMILES | CC1(NC(=O)Oc2ccc([N+](=O)[O-])cc2)CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H25Cl2N7O4/c1-30(36-29(40)43-22-12-10-21(11-13-22)39(41)42)14-16-37(17-15-30)27-25-28(34-18-33-27)38(20-8-6-19(31)7-9-20)26(35-25)23-4-2-3-5-24(23)32/h2-13,18H,14-17H2,1H3,(H,36,40) |
| InChIKey | SIJKHLCBVHJOAC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|