C27H28Cl2N6O3 — CID 171532487
1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)-2-(3-hydroxypropoxy)purin-6-yl]-4-methylpiperidine-4-carboxamide (PubChem CID 171532487) has the molecular formula C27H28Cl2N6O3 and a molecular weight of 555.47 g/mol. Its IUPAC name is 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)-2-(3-hydroxypropoxy)purin-6-yl]-4-methylpiperidine-4-carboxamide.
| Compound Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)-2-(3-hydroxypropoxy)purin-6-yl]-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171532487 |
| Molecular Formula | C27H28Cl2N6O3 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)-2-(3-hydroxypropoxy)purin-6-yl]-4-methylpiperidine-4-carboxamide |
| SMILES | CC1(C(N)=O)CCN(c2nc(OCCCO)nc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H28Cl2N6O3/c1-27(25(30)37)11-13-34(14-12-27)23-21-24(33-26(32-23)38-16-4-15-36)35(18-9-7-17(28)8-10-18)22(31-21)19-5-2-3-6-20(19)29/h2-3,5-10,36H,4,11-16H2,1H3,(H2,30,37) |
| InChIKey | QJQZVZLAVSRPRX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|