C29H36N8O5S — CID 146257368
[(1R)-1-(4-azidocyclohexyl)-2-[(2S)-4-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-(thiophen-2-ylmethylcarbamoyl)piperazin-1-yl]-2-oxoethyl]carbamic acid (PubChem CID 146257368) has the molecular formula C29H36N8O5S and a molecular weight of 608.73 g/mol. Its IUPAC name is [(1R)-1-(4-azidocyclohexyl)-2-[(2S)-4-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-(thiophen-2-ylmethylcarbamoyl)piperazin-1-yl]-2-oxoethyl]carbamic acid.
| Compound Name | [(1R)-1-(4-azidocyclohexyl)-2-[(2S)-4-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-(thiophen-2-ylmethylcarbamoyl)piperazin-1-yl]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 146257368 |
| Molecular Formula | C29H36N8O5S |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | [(1R)-1-(4-azidocyclohexyl)-2-[(2S)-4-[(4S,5S)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-(thiophen-2-ylmethylcarbamoyl)piperazin-1-yl]-2-oxoethyl]carbamic acid |
| SMILES | C[C@@H]1N=C(N2CCN(C(=O)[C@H](NC(=O)O)C3CCC(N=[N+]=[N-])CC3)[C@H](C(=O)NCc3cccs3)C2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H36N8O5S/c1-18-25(20-6-3-2-4-7-20)42-28(32-18)36-13-14-37(23(17-36)26(38)31-16-22-8-5-15-43-22)27(39)24(33-29(40)41)19-9-11-21(12-10-19)34-35-30/h2-8,15,18-19,21,23-25,33H,9-14,16-17H2,1H3,(H,31,38)(H,40,41)/t18-,19?,21?,23-,24+,25+/m0/s1 |
| InChIKey | VPTKURSMFYYYNA-HVRDSLBISA-N |
| XLogP | 3.90 |
| TPSA | 172.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|