C33H45N5O2S2 — CID 134533859
2-(4-azidocyclohexyl)-N-[(2S)-4-[(2R,3R)-3,4-dimethyl-2-phenyl-2,3-dihydrofuran-5-yl]-1-sulfanylidene-1-(thiophen-2-ylmethylamino)pentan-2-yl]-N-propylacetamide (PubChem CID 134533859) has the molecular formula C33H45N5O2S2 and a molecular weight of 607.89 g/mol. Its IUPAC name is 2-(4-azidocyclohexyl)-N-[(2S)-4-[(2R,3R)-3,4-dimethyl-2-phenyl-2,3-dihydrofuran-5-yl]-1-sulfanylidene-1-(thiophen-2-ylmethylamino)pentan-2-yl]-N-propylacetamide.
| Compound Name | 2-(4-azidocyclohexyl)-N-[(2S)-4-[(2R,3R)-3,4-dimethyl-2-phenyl-2,3-dihydrofuran-5-yl]-1-sulfanylidene-1-(thiophen-2-ylmethylamino)pentan-2-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 134533859 |
| Molecular Formula | C33H45N5O2S2 |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-(4-azidocyclohexyl)-N-[(2S)-4-[(2R,3R)-3,4-dimethyl-2-phenyl-2,3-dihydrofuran-5-yl]-1-sulfanylidene-1-(thiophen-2-ylmethylamino)pentan-2-yl]-N-propylacetamide |
| SMILES | CCCN(C(=O)CC1CCC(N=[N+]=[N-])CC1)[C@@H](CC(C)C1=C(C)[C@@H](C)[C@H](c2ccccc2)O1)C(=S)NCc1cccs1 |
| InChI | InChI=1S/C33H45N5O2S2/c1-5-17-38(30(39)20-25-13-15-27(16-14-25)36-37-34)29(33(41)35-21-28-12-9-18-42-28)19-22(2)31-23(3)24(4)32(40-31)26-10-7-6-8-11-26/h6-12,18,22,24-25,27,29,32H,5,13-17,19-21H2,1-4H3,(H,35,41)/t22?,24-,25?,27?,29+,32-/m1/s1 |
| InChIKey | XJZHFWFITGIYJW-ARTYTLRPSA-N |
| XLogP | 8.74 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|