C34H38N4O3 — CID 146257962
(5R)-5-[3-[(E)-2-[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]ethenyl]-1H-indazol-6-yl]-8-methoxy-3,4,5,6-tetrahydro-1H-1-benzazocin-2-one (PubChem CID 146257962) has the molecular formula C34H38N4O3 and a molecular weight of 550.70 g/mol. Its IUPAC name is (5R)-5-[3-[(E)-2-[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]ethenyl]-1H-indazol-6-yl]-8-methoxy-3,4,5,6-tetrahydro-1H-1-benzazocin-2-one.
| Compound Name | (5R)-5-[3-[(E)-2-[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]ethenyl]-1H-indazol-6-yl]-8-methoxy-3,4,5,6-tetrahydro-1H-1-benzazocin-2-one |
|---|---|
| PubChem CID | 146257962 |
| Molecular Formula | C34H38N4O3 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | (5R)-5-[3-[(E)-2-[4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]ethenyl]-1H-indazol-6-yl]-8-methoxy-3,4,5,6-tetrahydro-1H-1-benzazocin-2-one |
| SMILES | COc1ccc2c(c1)C[C@H](c1ccc3c(/C=C/c4ccc(CN5C[C@@H](C)O[C@@H](C)C5)cc4)n[nH]c3c1)CCC(=O)N2 |
| InChI | InChI=1S/C34H38N4O3/c1-22-19-38(20-23(2)41-22)21-25-6-4-24(5-7-25)8-13-32-30-12-9-27(18-33(30)37-36-32)26-10-15-34(39)35-31-14-11-29(40-3)17-28(31)16-26/h4-9,11-14,17-18,22-23,26H,10,15-16,19-21H2,1-3H3,(H,35,39)(H,36,37)/b13-8+/t22-,23+,26-/m1/s1 |
| InChIKey | PLTVKJGZAPIBRX-HSDMGCLVSA-N |
| XLogP | 6.41 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |