C27H31N5O3 — CID 146258000
[4-(4-methylpiperazin-1-yl)phenyl]-[[6-(2-phenoxyethoxy)-1H-indazol-3-yl]amino]methanol (PubChem CID 146258000) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)phenyl]-[[6-(2-phenoxyethoxy)-1H-indazol-3-yl]amino]methanol.
| Compound Name | [4-(4-methylpiperazin-1-yl)phenyl]-[[6-(2-phenoxyethoxy)-1H-indazol-3-yl]amino]methanol |
|---|---|
| PubChem CID | 146258000 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)phenyl]-[[6-(2-phenoxyethoxy)-1H-indazol-3-yl]amino]methanol |
| SMILES | CN1CCN(c2ccc(C(O)Nc3n[nH]c4cc(OCCOc5ccccc5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C27H31N5O3/c1-31-13-15-32(16-14-31)21-9-7-20(8-10-21)27(33)28-26-24-12-11-23(19-25(24)29-30-26)35-18-17-34-22-5-3-2-4-6-22/h2-12,19,27,33H,13-18H2,1H3,(H2,28,29,30) |
| InChIKey | KCPWHDXSNUAHDY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|