C14H19N3O4 — CID 146261685
(2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)-N-[(1R)-1-hydroxyprop-2-enyl]propanamide (PubChem CID 146261685) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)-N-[(1R)-1-hydroxyprop-2-enyl]propanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)-N-[(1R)-1-hydroxyprop-2-enyl]propanamide |
|---|---|
| PubChem CID | 146261685 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)-N-[(1R)-1-hydroxyprop-2-enyl]propanamide |
| SMILES | C=C[C@@H](O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CN |
| InChI | InChI=1S/C14H19N3O4/c1-2-12(19)17-14(21)11(16-13(20)8-15)7-9-3-5-10(18)6-4-9/h2-6,11-12,18-19H,1,7-8,15H2,(H,16,20)(H,17,21)/t11-,12+/m0/s1 |
| InChIKey | CAIUBLYDQHFMEB-NWDGAFQWSA-N |
| XLogP | -1.00 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|