C18H36O3 — CID 146262073
(3,4-diethyl-6-hydroxy-3,4,7-trimethylnonan-2-yl) acetate (PubChem CID 146262073) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is (3,4-diethyl-6-hydroxy-3,4,7-trimethylnonan-2-yl) acetate.
| Compound Name | (3,4-diethyl-6-hydroxy-3,4,7-trimethylnonan-2-yl) acetate |
|---|---|
| PubChem CID | 146262073 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | (3,4-diethyl-6-hydroxy-3,4,7-trimethylnonan-2-yl) acetate |
| SMILES | CCC(C)C(O)CC(C)(CC)C(C)(CC)C(C)OC(C)=O |
| InChI | InChI=1S/C18H36O3/c1-9-13(4)16(20)12-17(7,10-2)18(8,11-3)14(5)21-15(6)19/h13-14,16,20H,9-12H2,1-8H3 |
| InChIKey | YTNQUMAMOKWVRG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |