C13H25IO2S — CID 146262461
4-methylpentan-2-yl 4-iodosulfanyl-2,4-dimethylpentanoate (PubChem CID 146262461) has the molecular formula C13H25IO2S and a molecular weight of 372.31 g/mol. Its IUPAC name is 4-methylpentan-2-yl 4-iodosulfanyl-2,4-dimethylpentanoate.
| Compound Name | 4-methylpentan-2-yl 4-iodosulfanyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 146262461 |
| Molecular Formula | C13H25IO2S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-methylpentan-2-yl 4-iodosulfanyl-2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)OC(=O)C(C)CC(C)(C)SI |
| InChI | InChI=1S/C13H25IO2S/c1-9(2)7-11(4)16-12(15)10(3)8-13(5,6)17-14/h9-11H,7-8H2,1-6H3 |
| InChIKey | SSSUHJYSIZAOJL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|