C16H30O7S — CID 20812935
4-methylpentan-2-yl 3,3-dimethyl-5-[2-(trioxidanylsulfanyl)acetyl]oxyhexanoate (PubChem CID 20812935) has the molecular formula C16H30O7S and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-methylpentan-2-yl 3,3-dimethyl-5-[2-(trioxidanylsulfanyl)acetyl]oxyhexanoate.
| Compound Name | 4-methylpentan-2-yl 3,3-dimethyl-5-[2-(trioxidanylsulfanyl)acetyl]oxyhexanoate |
|---|---|
| PubChem CID | 20812935 |
| Molecular Formula | C16H30O7S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 4-methylpentan-2-yl 3,3-dimethyl-5-[2-(trioxidanylsulfanyl)acetyl]oxyhexanoate |
| SMILES | CC(C)CC(C)OC(=O)CC(C)(C)CC(C)OC(=O)CSOOO |
| InChI | InChI=1S/C16H30O7S/c1-11(2)7-12(3)20-14(17)9-16(5,6)8-13(4)21-15(18)10-24-23-22-19/h11-13,19H,7-10H2,1-6H3 |
| InChIKey | AUQSTIFZHJIBBM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|