About [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate
[(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate (PubChem CID 124738332) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate.
Molecular Properties
| Compound Name | [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate |
| PubChem CID | 124738332 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[C@H](C)CC(C)(C)O |
| InChI | InChI=1S/C12H24O3/c1-9(2)6-7-11(13)15-10(3)8-12(4,5)14/h9-10,14H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | QSSSNOFLCMCMMP-SNVBAGLBSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate?
The IUPAC name of [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate (CID 124738332) is [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate.
What is the SMILES notation for [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate?
The canonical SMILES for [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate is CC(C)CCC(=O)O[C@H](C)CC(C)(C)O.
What is the InChIKey of [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate?
The InChIKey is QSSSNOFLCMCMMP-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H24O3/c1-9(2)6-7-11(13)15-10(3)8-12(4,5)14/h9-10,14H,6-8H2,1-5H3/t10-/m1/s1.
What are the key properties of [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate?
[(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate has a molecular weight of 216.32 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-hydroxy-4-methylpentan-2-yl] 4-methylpentanoate is sourced from PubChem (CID 124738332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).