C18H17F3N5OS- — CID 146268991
CID 146268991 (PubChem CID 146268991) has the molecular formula C18H17F3N5OS- and a molecular weight of 408.43 g/mol.
| Compound Name | CID 146268991 |
|---|---|
| PubChem CID | 146268991 |
| Molecular Formula | C18H17F3N5OS- |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | — |
| SMILES | CC/N=[S-](=O)/c1cc(C2CC2)cnc1-c1nc2cc(C(F)(F)F)ncc2n1C |
| InChI | InChI=1S/C18H17F3N5OS/c1-3-24-28(27)14-6-11(10-4-5-10)8-23-16(14)17-25-12-7-15(18(19,20)21)22-9-13(12)26(17)2/h6-10H,3-5H2,1-2H3/q-1 |
| InChIKey | OXHWROOHRCEOMR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|