C17H16F3N6OS- — CID 146269013
CID 146269013 (PubChem CID 146269013) has the molecular formula C17H16F3N6OS- and a molecular weight of 409.42 g/mol.
| Compound Name | CID 146269013 |
|---|---|
| PubChem CID | 146269013 |
| Molecular Formula | C17H16F3N6OS- |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | — |
| SMILES | CC/N=[S-](=O)/c1cc(C2CC2)cnc1-c1nc2cc(C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C17H16F3N6OS/c1-3-22-28(27)12-6-10(9-4-5-9)8-21-14(12)16-23-11-7-13(17(18,19)20)24-25-15(11)26(16)2/h6-9H,3-5H2,1-2H3/q-1 |
| InChIKey | BHILKCMEEKBAHU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|