C23H19F5N6O2S — CID 167506602
6-[5-(6-cyclopropyl-2-pyridinyl)-3-ethylsulfonyl-2-pyridinyl]-7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazine (PubChem CID 167506602) has the molecular formula C23H19F5N6O2S and a molecular weight of 538.50 g/mol. Its IUPAC name is 6-[5-(6-cyclopropyl-2-pyridinyl)-3-ethylsulfonyl-2-pyridinyl]-7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazine.
| Compound Name | 6-[5-(6-cyclopropyl-2-pyridinyl)-3-ethylsulfonyl-2-pyridinyl]-7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazine |
|---|---|
| PubChem CID | 167506602 |
| Molecular Formula | C23H19F5N6O2S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 6-[5-(6-cyclopropyl-2-pyridinyl)-3-ethylsulfonyl-2-pyridinyl]-7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazine |
| SMILES | CCS(=O)(=O)c1cc(-c2cccc(C3CC3)n2)cnc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C23H19F5N6O2S/c1-3-37(35,36)17-9-13(15-6-4-5-14(30-15)12-7-8-12)11-29-19(17)21-31-16-10-18(22(24,25)23(26,27)28)32-33-20(16)34(21)2/h4-6,9-12H,3,7-8H2,1-2H3 |
| InChIKey | OCRBDQMRIGJQJZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 103.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|