C22H18F5N7O2S — CID 168853939
2-[5-(5-cyclopropyl-1,2,4-triazin-3-yl)-3-ethylsulfonyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine (PubChem CID 168853939) has the molecular formula C22H18F5N7O2S and a molecular weight of 539.49 g/mol. Its IUPAC name is 2-[5-(5-cyclopropyl-1,2,4-triazin-3-yl)-3-ethylsulfonyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-[5-(5-cyclopropyl-1,2,4-triazin-3-yl)-3-ethylsulfonyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 168853939 |
| Molecular Formula | C22H18F5N7O2S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 2-[5-(5-cyclopropyl-1,2,4-triazin-3-yl)-3-ethylsulfonyl-2-pyridinyl]-3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1cc(-c2nncc(C3CC3)n2)cnc1-c1nc2cc(C(F)(F)C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C22H18F5N7O2S/c1-3-37(35,36)16-6-12(18-31-15(10-30-33-18)11-4-5-11)8-28-17(16)20-32-14-7-13(9-29-19(14)34(20)2)21(23,24)22(25,26)27/h6-11H,3-5H2,1-2H3 |
| InChIKey | ZYGZDIDQCOOAAO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 116.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|