C17H14F5N5O4S — CID 146440946
5-ethylsulfonyl-3-methyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxylic acid (PubChem CID 146440946) has the molecular formula C17H14F5N5O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is 5-ethylsulfonyl-3-methyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxylic acid.
| Compound Name | 5-ethylsulfonyl-3-methyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 146440946 |
| Molecular Formula | C17H14F5N5O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 5-ethylsulfonyl-3-methyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxylic acid |
| SMILES | CCS(=O)(=O)c1cc(C)c(C(=O)O)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C17H14F5N5O4S/c1-4-32(30,31)9-5-7(2)11(15(28)29)24-12(9)14-23-8-6-10(16(18,19)17(20,21)22)25-26-13(8)27(14)3/h5-6H,4H2,1-3H3,(H,28,29) |
| InChIKey | OLJXVPHDAOGFLI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|