C20H21F5N6O4S2 — CID 167179655
methyl (3Z)-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboximidate (PubChem CID 167179655) has the molecular formula C20H21F5N6O4S2 and a molecular weight of 568.55 g/mol. Its IUPAC name is methyl (3Z)-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboximidate.
| Compound Name | methyl (3Z)-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboximidate |
|---|---|
| PubChem CID | 167179655 |
| Molecular Formula | C20H21F5N6O4S2 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | methyl (3Z)-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-N-(2-methylsulfanylethoxy)pyridine-3-carboximidate |
| SMILES | CCS(=O)(=O)c1cc(/C(=N/OCCSC)OC)cnc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C20H21F5N6O4S2/c1-5-37(32,33)13-8-11(18(34-3)30-35-6-7-36-4)10-26-15(13)17-27-12-9-14(19(21,22)20(23,24)25)28-29-16(12)31(17)2/h8-10H,5-7H2,1-4H3/b30-18- |
| InChIKey | WTCJTCBSWQWSEB-YKQZZPSBSA-N |
| XLogP | 3.56 |
| TPSA | 121.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|