C20H15F4N3O2 — CID 146269039
2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 146269039) has the molecular formula C20H15F4N3O2 and a molecular weight of 405.35 g/mol. Its IUPAC name is 2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146269039 |
| Molecular Formula | C20H15F4N3O2 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(-c2ccccc2)c(F)c1F)c1c2n([nH]c1=O)CCCC2 |
| InChI | InChI=1S/C20H15F4N3O2/c21-14-12(10-6-2-1-3-7-10)15(22)17(24)18(16(14)23)25-19(28)13-11-8-4-5-9-27(11)26-20(13)29/h1-3,6-7H,4-5,8-9H2,(H,25,28)(H,26,29) |
| InChIKey | BVDZLMVPCLOVRD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|