C20H10ClF4N3O2 — CID 166626236
7-chloro-2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 166626236) has the molecular formula C20H10ClF4N3O2 and a molecular weight of 435.76 g/mol. Its IUPAC name is 7-chloro-2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 7-chloro-2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166626236 |
| Molecular Formula | C20H10ClF4N3O2 |
| Molecular Weight | 435.76 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 7-chloro-2-oxo-N-(2,3,5,6-tetrafluoro-4-phenylphenyl)-1H-pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(-c2ccccc2)c(F)c1F)c1c(=O)[nH]n2c(Cl)cccc12 |
| InChI | InChI=1S/C20H10ClF4N3O2/c21-11-8-4-7-10-13(20(30)27-28(10)11)19(29)26-18-16(24)14(22)12(15(23)17(18)25)9-5-2-1-3-6-9/h1-8H,(H,26,29)(H,27,30) |
| InChIKey | YQTNXUWOGRYXAE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|