C17H21ClN2O — CID 146269453
(2Z,4Z)-6-amino-3-chloro-2-methyl-N-(2-propan-2-ylphenyl)hepta-2,4,6-trienamide (PubChem CID 146269453) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is (2Z,4Z)-6-amino-3-chloro-2-methyl-N-(2-propan-2-ylphenyl)hepta-2,4,6-trienamide.
| Compound Name | (2Z,4Z)-6-amino-3-chloro-2-methyl-N-(2-propan-2-ylphenyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 146269453 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2Z,4Z)-6-amino-3-chloro-2-methyl-N-(2-propan-2-ylphenyl)hepta-2,4,6-trienamide |
| SMILES | C=C(N)/C=C\C(Cl)=C(/C)C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C17H21ClN2O/c1-11(2)14-7-5-6-8-16(14)20-17(21)13(4)15(18)10-9-12(3)19/h5-11H,3,19H2,1-2,4H3,(H,20,21)/b10-9-,15-13- |
| InChIKey | BJLHBYZHHJJHFT-WQJRBICESA-N |
| XLogP | 4.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|