C12H14FNO — CID 146271306
2-[2-(3,4-dihydro-2H-pyrrol-2-yl)-4-fluorophenyl]ethanol (PubChem CID 146271306) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-pyrrol-2-yl)-4-fluorophenyl]ethanol.
| Compound Name | 2-[2-(3,4-dihydro-2H-pyrrol-2-yl)-4-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 146271306 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-pyrrol-2-yl)-4-fluorophenyl]ethanol |
| SMILES | OCCc1ccc(F)cc1C1CCC=N1 |
| InChI | InChI=1S/C12H14FNO/c13-10-4-3-9(5-7-15)11(8-10)12-2-1-6-14-12/h3-4,6,8,12,15H,1-2,5,7H2 |
| InChIKey | JIQPPAOBVVQWIN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |