C11H12FNO — CID 90996519
2-(4-fluorophenyl)-2,3,4,5-tetrahydropyridin-4-ol (PubChem CID 90996519) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2,3,4,5-tetrahydropyridin-4-ol.
| Compound Name | 2-(4-fluorophenyl)-2,3,4,5-tetrahydropyridin-4-ol |
|---|---|
| PubChem CID | 90996519 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(4-fluorophenyl)-2,3,4,5-tetrahydropyridin-4-ol |
| SMILES | OC1CC=NC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H12FNO/c12-9-3-1-8(2-4-9)11-7-10(14)5-6-13-11/h1-4,6,10-11,14H,5,7H2 |
| InChIKey | CHEXBCOKLNBZHR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |