C14H12N4O2 — CID 146271561
3-methyl-N-(2-nitrophenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 146271561) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-methyl-N-(2-nitrophenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 3-methyl-N-(2-nitrophenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 146271561 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-methyl-N-(2-nitrophenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Cc1c[nH]c2nc(Nc3ccccc3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C14H12N4O2/c1-9-8-15-14-10(9)6-7-13(17-14)16-11-4-2-3-5-12(11)18(19)20/h2-8H,1H3,(H2,15,16,17) |
| InChIKey | DQKDHUKUFCHWMS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|