C23H20N4O5 — CID 146271564
(3,5-dimethoxyphenyl)-[6-(2-methyl-6-nitroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 146271564) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[6-(2-methyl-6-nitroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3,5-dimethoxyphenyl)-[6-(2-methyl-6-nitroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 146271564 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[6-(2-methyl-6-nitroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2c[nH]c3nc(Nc4c(C)cccc4[N+](=O)[O-])ccc23)c1 |
| InChI | InChI=1S/C23H20N4O5/c1-13-5-4-6-19(27(29)30)21(13)25-20-8-7-17-18(12-24-23(17)26-20)22(28)14-9-15(31-2)11-16(10-14)32-3/h4-12H,1-3H3,(H2,24,25,26) |
| InChIKey | ZQEMNMUUSOJAHB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|