C24H28FN3O4 — CID 142350935
5-[(Z)-2-(3,5-dimethoxyphenyl)-1-fluoroethenyl]-N-(2-methyl-6-nitrophenyl)-1,2-dihydropyridin-2-amine;ethane (PubChem CID 142350935) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-[(Z)-2-(3,5-dimethoxyphenyl)-1-fluoroethenyl]-N-(2-methyl-6-nitrophenyl)-1,2-dihydropyridin-2-amine;ethane.
| Compound Name | 5-[(Z)-2-(3,5-dimethoxyphenyl)-1-fluoroethenyl]-N-(2-methyl-6-nitrophenyl)-1,2-dihydropyridin-2-amine;ethane |
|---|---|
| PubChem CID | 142350935 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 5-[(Z)-2-(3,5-dimethoxyphenyl)-1-fluoroethenyl]-N-(2-methyl-6-nitrophenyl)-1,2-dihydropyridin-2-amine;ethane |
| SMILES | CC.COc1cc(/C=C(\F)C2=CNC(Nc3c(C)cccc3[N+](=O)[O-])C=C2)cc(OC)c1 |
| InChI | InChI=1S/C22H22FN3O4.C2H6/c1-14-5-4-6-20(26(27)28)22(14)25-21-8-7-16(13-24-21)19(23)11-15-9-17(29-2)12-18(10-15)30-3;1-2/h4-13,21,24-25H,1-3H3;1-2H3/b19-11-; |
| InChIKey | JIQLBUWBWOSCBH-XHFAFUTOSA-N |
| XLogP | 5.74 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|