C12H16ClN — CID 146272450
1-(4-chloro-2-methylphenyl)-2-methylpyrrolidine (PubChem CID 146272450) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-2-methylpyrrolidine.
| Compound Name | 1-(4-chloro-2-methylphenyl)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 146272450 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-2-methylpyrrolidine |
| SMILES | Cc1cc(Cl)ccc1N1CCCC1C |
| InChI | InChI=1S/C12H16ClN/c1-9-8-11(13)5-6-12(9)14-7-3-4-10(14)2/h5-6,8,10H,3-4,7H2,1-2H3 |
| InChIKey | HHXDEBYMWLAJLU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |