C20H19ClN2O2 — CID 168516573
2-[5-chloro-2-(2-methylpiperidin-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168516573) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-methylpiperidin-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[5-chloro-2-(2-methylpiperidin-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516573 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[5-chloro-2-(2-methylpiperidin-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | CC1CCCCN1c1ccc(Cl)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19ClN2O2/c1-13-6-4-5-11-22(13)17-10-9-14(21)12-18(17)23-19(24)15-7-2-3-8-16(15)20(23)25/h2-3,7-10,12-13H,4-6,11H2,1H3 |
| InChIKey | VJONMIZATMHOTF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|