About (4-bromophenyl) pyrazole-1-carboxylate
(4-bromophenyl) pyrazole-1-carboxylate (PubChem CID 146272533) has the molecular formula C10H7BrN2O2
and a molecular weight of 267.08 g/mol. Its IUPAC name is (4-bromophenyl) pyrazole-1-carboxylate.
Molecular Properties
| Compound Name | (4-bromophenyl) pyrazole-1-carboxylate |
| PubChem CID | 146272533 |
| Molecular Formula | C10H7BrN2O2 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | (4-bromophenyl) pyrazole-1-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1)n1cccn1 |
| InChI | InChI=1S/C10H7BrN2O2/c11-8-2-4-9(5-3-8)15-10(14)13-7-1-6-12-13/h1-7H |
| InChIKey | CKGNLCCWNYYGPG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl) pyrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) pyrazole-1-carboxylate?
The IUPAC name of (4-bromophenyl) pyrazole-1-carboxylate (CID 146272533) is (4-bromophenyl) pyrazole-1-carboxylate.
What is the SMILES notation for (4-bromophenyl) pyrazole-1-carboxylate?
The canonical SMILES for (4-bromophenyl) pyrazole-1-carboxylate is O=C(Oc1ccc(Br)cc1)n1cccn1.
What is the InChIKey of (4-bromophenyl) pyrazole-1-carboxylate?
The InChIKey is CKGNLCCWNYYGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN2O2/c11-8-2-4-9(5-3-8)15-10(14)13-7-1-6-12-13/h1-7H.
What are the key properties of (4-bromophenyl) pyrazole-1-carboxylate?
(4-bromophenyl) pyrazole-1-carboxylate has a molecular weight of 267.08 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) pyrazole-1-carboxylate is sourced from PubChem (CID 146272533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).