C9H7Cl2N3O — CID 146272702
4-(chloromethyl)-3-(6-chloropyridazin-3-yl)-5-methyl-1,2-oxazole (PubChem CID 146272702) has the molecular formula C9H7Cl2N3O and a molecular weight of 244.08 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(6-chloropyridazin-3-yl)-5-methyl-1,2-oxazole.
| Compound Name | 4-(chloromethyl)-3-(6-chloropyridazin-3-yl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 146272702 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 4-(chloromethyl)-3-(6-chloropyridazin-3-yl)-5-methyl-1,2-oxazole |
| SMILES | Cc1onc(-c2ccc(Cl)nn2)c1CCl |
| InChI | InChI=1S/C9H7Cl2N3O/c1-5-6(4-10)9(14-15-5)7-2-3-8(11)13-12-7/h2-3H,4H2,1H3 |
| InChIKey | KTNPHPWYBCSYAP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|