C30H36N4O — CID 146274812
4-[5-[4-[4-(dimethylamino)butyl]-3-methylphenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide (PubChem CID 146274812) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 4-[5-[4-[4-(dimethylamino)butyl]-3-methylphenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide.
| Compound Name | 4-[5-[4-[4-(dimethylamino)butyl]-3-methylphenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 146274812 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 4-[5-[4-[4-(dimethylamino)butyl]-3-methylphenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide |
| SMILES | Cc1cc(-c2cnc3[nH]cc(-c4ccc(C(=O)N(C)C)c(C)c4)c3c2)ccc1CCCCN(C)C |
| InChI | InChI=1S/C30H36N4O/c1-20-15-23(11-10-22(20)9-7-8-14-33(3)4)25-17-27-28(19-32-29(27)31-18-25)24-12-13-26(21(2)16-24)30(35)34(5)6/h10-13,15-19H,7-9,14H2,1-6H3,(H,31,32) |
| InChIKey | QVIUHNHECYUXHE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|