C23H20N4O3 — CID 172556690
4-[5-[4-amino-3-(dimethylcarbamoyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid (PubChem CID 172556690) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[5-[4-amino-3-(dimethylcarbamoyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid.
| Compound Name | 4-[5-[4-amino-3-(dimethylcarbamoyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 172556690 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[5-[4-amino-3-(dimethylcarbamoyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzoic acid |
| SMILES | CN(C)C(=O)c1cc(-c2cnc3[nH]cc(-c4ccc(C(=O)O)cc4)c3c2)ccc1N |
| InChI | InChI=1S/C23H20N4O3/c1-27(2)22(28)18-9-15(7-8-20(18)24)16-10-17-19(12-26-21(17)25-11-16)13-3-5-14(6-4-13)23(29)30/h3-12H,24H2,1-2H3,(H,25,26)(H,29,30) |
| InChIKey | IEJJGDGUYNTEHL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|