C20H24N4O — CID 166629908
2-amino-5-(3,4-diethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylbenzamide (PubChem CID 166629908) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-5-(3,4-diethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylbenzamide.
| Compound Name | 2-amino-5-(3,4-diethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166629908 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-amino-5-(3,4-diethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-N,N-dimethylbenzamide |
| SMILES | CCc1c[nH]c2ncc(-c3ccc(N)c(C(=O)N(C)C)c3)c(CC)c12 |
| InChI | InChI=1S/C20H24N4O/c1-5-12-10-22-19-18(12)14(6-2)16(11-23-19)13-7-8-17(21)15(9-13)20(25)24(3)4/h7-11H,5-6,21H2,1-4H3,(H,22,23) |
| InChIKey | FJVYXMUBCZZWFG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|