C23H20FN5O2 — CID 172556696
6-amino-3-[3-(4-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 172556696) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 6-amino-3-[3-(4-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[3-(4-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 172556696 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 6-amino-3-[3-(4-carbamoylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3[nH]cc(-c4ccc(C(N)=O)cc4)c3c2)c1F |
| InChI | InChI=1S/C23H20FN5O2/c1-29(2)23(31)19-18(25)8-7-15(20(19)24)14-9-16-17(11-28-22(16)27-10-14)12-3-5-13(6-4-12)21(26)30/h3-11H,25H2,1-2H3,(H2,26,30)(H,27,28) |
| InChIKey | DEQOGDNUGAQTHS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|