C18H18ClFN4O2 — CID 148523221
6-amino-3-[2-chloro-3-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 148523221) has the molecular formula C18H18ClFN4O2 and a molecular weight of 376.82 g/mol. Its IUPAC name is 6-amino-3-[2-chloro-3-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[2-chloro-3-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 148523221 |
| Molecular Formula | C18H18ClFN4O2 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 6-amino-3-[2-chloro-3-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | COCc1c(Cl)[nH]c2ncc(-c3ccc(N)c(C(=O)N(C)C)c3F)cc12 |
| InChI | InChI=1S/C18H18ClFN4O2/c1-24(2)18(25)14-13(21)5-4-10(15(14)20)9-6-11-12(8-26-3)16(19)23-17(11)22-7-9/h4-7H,8,21H2,1-3H3,(H,22,23) |
| InChIKey | MOVADMTYVANKRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|