C19H19ClFN3O2 — CID 158411056
6-amino-3-[6-chloro-5-(2-hydroxyethyl)-7H-cyclopenta[b]pyridin-3-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 158411056) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is 6-amino-3-[6-chloro-5-(2-hydroxyethyl)-7H-cyclopenta[b]pyridin-3-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[6-chloro-5-(2-hydroxyethyl)-7H-cyclopenta[b]pyridin-3-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 158411056 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 6-amino-3-[6-chloro-5-(2-hydroxyethyl)-7H-cyclopenta[b]pyridin-3-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2)C(CCO)=C(Cl)C3)c1F |
| InChI | InChI=1S/C19H19ClFN3O2/c1-24(2)19(26)17-15(22)4-3-11(18(17)21)10-7-13-12(5-6-25)14(20)8-16(13)23-9-10/h3-4,7,9,25H,5-6,8,22H2,1-2H3 |
| InChIKey | GZHWOZXTPOGCAL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|