C19H20ClFN4O2 — CID 146536722
6-amino-3-[(2'S,3R)-4-chloro-2'-(hydroxymethyl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 146536722) has the molecular formula C19H20ClFN4O2 and a molecular weight of 390.85 g/mol. Its IUPAC name is 6-amino-3-[(2'S,3R)-4-chloro-2'-(hydroxymethyl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(2'S,3R)-4-chloro-2'-(hydroxymethyl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146536722 |
| Molecular Formula | C19H20ClFN4O2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 6-amino-3-[(2'S,3R)-4-chloro-2'-(hydroxymethyl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2Cl)[C@@]2(CN3)C[C@@H]2CO)c1F |
| InChI | InChI=1S/C19H20ClFN4O2/c1-25(2)18(27)13-12(22)4-3-10(16(13)21)11-6-23-17-14(15(11)20)19(8-24-17)5-9(19)7-26/h3-4,6,9,26H,5,7-8,22H2,1-2H3,(H,23,24)/t9-,19-/m1/s1 |
| InChIKey | GPCZAJRWDDMWBB-AYLIAGHASA-N |
| XLogP | 2.50 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|