C22H24ClFN8O — CID 166034780
6-amino-3-[(3R,3'S)-3'-(5-amino-1,2,4-triazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 166034780) has the molecular formula C22H24ClFN8O and a molecular weight of 470.94 g/mol. Its IUPAC name is 6-amino-3-[(3R,3'S)-3'-(5-amino-1,2,4-triazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(3R,3'S)-3'-(5-amino-1,2,4-triazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166034780 |
| Molecular Formula | C22H24ClFN8O |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 6-amino-3-[(3R,3'S)-3'-(5-amino-1,2,4-triazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2Cl)[C@]2(CC[C@H](n4ncnc4N)C2)CN3)c1F |
| InChI | InChI=1S/C22H24ClFN8O/c1-31(2)20(33)15-14(25)4-3-12(18(15)24)13-8-27-19-16(17(13)23)22(9-28-19)6-5-11(7-22)32-21(26)29-10-30-32/h3-4,8,10-11H,5-7,9,25H2,1-2H3,(H,27,28)(H2,26,29,30)/t11-,22-/m0/s1 |
| InChIKey | LRWBWZRARXCYSL-SAHAZLINSA-N |
| XLogP | 3.09 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|