C24H26ClFN6O — CID 172836380
6-amino-3-[(3S,3'R)-4-chloro-3'-(3-methylpyrazol-1-yl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 172836380) has the molecular formula C24H26ClFN6O and a molecular weight of 468.96 g/mol. Its IUPAC name is 6-amino-3-[(3S,3'R)-4-chloro-3'-(3-methylpyrazol-1-yl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(3S,3'R)-4-chloro-3'-(3-methylpyrazol-1-yl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 172836380 |
| Molecular Formula | C24H26ClFN6O |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 6-amino-3-[(3S,3'R)-4-chloro-3'-(3-methylpyrazol-1-yl)spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | Cc1ccn([C@@H]2CC[C@]3(CNc4ncc(-c5ccc(N)c(C(=O)N(C)C)c5F)c(Cl)c43)C2)n1 |
| InChI | InChI=1S/C24H26ClFN6O/c1-13-7-9-32(30-13)14-6-8-24(10-14)12-29-22-19(24)20(25)16(11-28-22)15-4-5-17(27)18(21(15)26)23(33)31(2)3/h4-5,7,9,11,14H,6,8,10,12,27H2,1-3H3,(H,28,29)/t14-,24-/m1/s1 |
| InChIKey | WEXZOLRJOSDEFV-JBEBIEQOSA-N |
| XLogP | 4.42 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|