C23H25ClFN7O — CID 166034589
6-amino-3-[3'-(3-aminopyrazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 166034589) has the molecular formula C23H25ClFN7O and a molecular weight of 469.95 g/mol. Its IUPAC name is 6-amino-3-[3'-(3-aminopyrazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[3'-(3-aminopyrazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166034589 |
| Molecular Formula | C23H25ClFN7O |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 6-amino-3-[3'-(3-aminopyrazol-1-yl)-4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2Cl)C2(CCC(n4ccc(N)n4)C2)CN3)c1F |
| InChI | InChI=1S/C23H25ClFN7O/c1-31(2)22(33)17-15(26)4-3-13(20(17)25)14-10-28-21-18(19(14)24)23(11-29-21)7-5-12(9-23)32-8-6-16(27)30-32/h3-4,6,8,10,12H,5,7,9,11,26H2,1-2H3,(H2,27,30)(H,28,29) |
| InChIKey | LWLBVGQFOHHYNV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|