C21H24ClFN4O2 — CID 146537061
6-amino-3-[(1'S,3R)-4-chloro-1'-hydroxy-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 146537061) has the molecular formula C21H24ClFN4O2 and a molecular weight of 418.90 g/mol. Its IUPAC name is 6-amino-3-[(1'S,3R)-4-chloro-1'-hydroxy-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(1'S,3R)-4-chloro-1'-hydroxy-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146537061 |
| Molecular Formula | C21H24ClFN4O2 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 6-amino-3-[(1'S,3R)-4-chloro-1'-hydroxy-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2Cl)[C@]2(CC[C@](C)(O)C2)CN3)c1F |
| InChI | InChI=1S/C21H24ClFN4O2/c1-20(29)6-7-21(9-20)10-26-18-15(21)16(22)12(8-25-18)11-4-5-13(24)14(17(11)23)19(28)27(2)3/h4-5,8,29H,6-7,9-10,24H2,1-3H3,(H,25,26)/t20-,21-/m0/s1 |
| InChIKey | UHMMACJZVKJFLR-SFTDATJTSA-N |
| XLogP | 3.42 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|