C19H17FN4O3 — CID 172556695
(E)-3-[5-[4-amino-3-(dimethylcarbamoyl)-2-fluorophenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 172556695) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is (E)-3-[5-[4-amino-3-(dimethylcarbamoyl)-2-fluorophenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-amino-3-(dimethylcarbamoyl)-2-fluorophenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 172556695 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (E)-3-[5-[4-amino-3-(dimethylcarbamoyl)-2-fluorophenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3[nH]cc(/C=C/C(=O)O)c3c2)c1F |
| InChI | InChI=1S/C19H17FN4O3/c1-24(2)19(27)16-14(21)5-4-12(17(16)20)11-7-13-10(3-6-15(25)26)8-22-18(13)23-9-11/h3-9H,21H2,1-2H3,(H,22,23)(H,25,26)/b6-3+ |
| InChIKey | TXMKLRSZIYFZGR-ZZXKWVIFSA-N |
| XLogP | 2.75 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|