C13H16N4O — CID 146276257
(Z,2S)-2-azido-4-(2-methylphenyl)hex-4-enamide (PubChem CID 146276257) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is (Z,2S)-2-azido-4-(2-methylphenyl)hex-4-enamide.
| Compound Name | (Z,2S)-2-azido-4-(2-methylphenyl)hex-4-enamide |
|---|---|
| PubChem CID | 146276257 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (Z,2S)-2-azido-4-(2-methylphenyl)hex-4-enamide |
| SMILES | C/C=C(/C[C@H](N=[N+]=[N-])C(N)=O)c1ccccc1C |
| InChI | InChI=1S/C13H16N4O/c1-3-10(8-12(13(14)18)16-17-15)11-7-5-4-6-9(11)2/h3-7,12H,8H2,1-2H3,(H2,14,18)/b10-3-/t12-/m0/s1 |
| InChIKey | KVBQVULLZANYNE-FALLNDSDSA-N |
| XLogP | 2.95 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|