C24H26ClN5O4 — CID 146279274
N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(hydroxyamino)ethylidene]-3,5-dimethoxybenzamide (PubChem CID 146279274) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(hydroxyamino)ethylidene]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(hydroxyamino)ethylidene]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 146279274 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(hydroxyamino)ethylidene]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)/N=C/C(NO)N2CCN(c3ccnc4cc(Cl)ccc34)CC2)c1 |
| InChI | InChI=1S/C24H26ClN5O4/c1-33-18-11-16(12-19(14-18)34-2)24(31)27-15-23(28-32)30-9-7-29(8-10-30)22-5-6-26-21-13-17(25)3-4-20(21)22/h3-6,11-15,23,28,32H,7-10H2,1-2H3/b27-15+ |
| InChIKey | RGPPDSCNSLMYBP-JFLMPSFJSA-N |
| XLogP | 3.24 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|