C27H38N4O4 — CID 146281938
2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-3-pyridinyl]acetic acid (PubChem CID 146281938) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 146281938 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(3-morpholin-4-ylpropoxy)-2-pyridinyl]-3-pyridinyl]acetic acid |
| SMILES | Cc1ncc(-c2ccc(OCCCN3CCOCC3)cn2)c(N2CCC(C)(C)CC2)c1CC(=O)O |
| InChI | InChI=1S/C27H38N4O4/c1-20-22(17-25(32)33)26(31-10-7-27(2,3)8-11-31)23(19-28-20)24-6-5-21(18-29-24)35-14-4-9-30-12-15-34-16-13-30/h5-6,18-19H,4,7-17H2,1-3H3,(H,32,33) |
| InChIKey | MLROOSLXKJRPHF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|