C24H30F3N3O5S — CID 153377886
propan-2-yl 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl]acetate (PubChem CID 153377886) has the molecular formula C24H30F3N3O5S and a molecular weight of 529.58 g/mol. Its IUPAC name is propan-2-yl 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl]acetate.
| Compound Name | propan-2-yl 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 153377886 |
| Molecular Formula | C24H30F3N3O5S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | propan-2-yl 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[5-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl]acetate |
| SMILES | Cc1ncc(-c2ccc(OS(=O)(=O)C(F)(F)F)cn2)c(N2CCC(C)(C)CC2)c1CC(=O)OC(C)C |
| InChI | InChI=1S/C24H30F3N3O5S/c1-15(2)34-21(31)12-18-16(3)28-14-19(22(18)30-10-8-23(4,5)9-11-30)20-7-6-17(13-29-20)35-36(32,33)24(25,26)27/h6-7,13-15H,8-12H2,1-5H3 |
| InChIKey | JHLXODVFHHDJJN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|